CAS 1142208-19-2 is the registry number for 4-Amino-6-(4-methylphenyl)-1,6-dihydro-1,3,5-triazine-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-amino-2-(4-methylphenyl)-2,5-dihydro-1H-1,3,5-triazine-6-thione (CAS 1142208-19-2) is a chemical compound with the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. IUPAC name: 4-amino-2-(4-methylphenyl)-2,5-dihydro-1H-1,3,5-triazine-6-thione. InChIKey: XZLHDMUUSXXMPW-UHFFFAOYSA-N.
| Molecular formula | C10H12N4S |
|---|---|
| Molecular weight | 220.30 g/mol |
| IUPAC name | 4-amino-2-(4-methylphenyl)-2,5-dihydro-1H-1,3,5-triazine-6-thione |
| InChIKey | XZLHDMUUSXXMPW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2NC(=S)NC(=N2)N |
Computed by PubChem (NCBI)