CAS 180537-84-2 is the registry number for 2,6-Diamino-4-isopropyl-4h-thiopyran-3,5-dicarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,6-diamino-4-propan-2-yl-4H-thiopyran-3,5-dicarbonitrile (CAS 180537-84-2) is a chemical compound with the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. IUPAC name: 2,6-diamino-4-propan-2-yl-4H-thiopyran-3,5-dicarbonitrile. InChIKey: JXNJFLYVHJFAPM-UHFFFAOYSA-N.
| Molecular formula | C10H12N4S |
|---|---|
| Molecular weight | 220.30 g/mol |
| IUPAC name | 2,6-diamino-4-propan-2-yl-4H-thiopyran-3,5-dicarbonitrile |
| InChIKey | JXNJFLYVHJFAPM-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=C(SC(=C1C#N)N)N)C#N |
Computed by PubChem (NCBI)