CAS 1308384-61-3 is the registry number for 4-(2,5-Dimethyl-3-thienyl)-2-hydrazinopyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[4-(2,5-dimethylthiophen-3-yl)pyrimidin-2-yl]hydrazine (CAS 1308384-61-3) is a chemical compound with the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. IUPAC name: [4-(2,5-dimethylthiophen-3-yl)pyrimidin-2-yl]hydrazine. InChIKey: MCNGZYOEQGDHHA-UHFFFAOYSA-N.
| Molecular formula | C10H12N4S |
|---|---|
| Molecular weight | 220.30 g/mol |
| IUPAC name | [4-(2,5-dimethylthiophen-3-yl)pyrimidin-2-yl]hydrazine |
| InChIKey | MCNGZYOEQGDHHA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)C)C2=NC(=NC=C2)NN |
Computed by PubChem (NCBI)