CAS 1379811-30-9 is the registry number for N-(5,6-Dimethyl-1,3-benzothiazol-2-yl)guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(5,6-dimethyl-1,3-benzothiazol-2-yl)guanidine (CAS 1379811-30-9) is a chemical compound with the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. IUPAC name: 2-(5,6-dimethyl-1,3-benzothiazol-2-yl)guanidine. InChIKey: KCQKCUSLNFSIOH-UHFFFAOYSA-N.
| Molecular formula | C10H12N4S |
|---|---|
| Molecular weight | 220.30 g/mol |
| IUPAC name | 2-(5,6-dimethyl-1,3-benzothiazol-2-yl)guanidine |
| InChIKey | KCQKCUSLNFSIOH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)SC(=N2)N=C(N)N |
Computed by PubChem (NCBI)