Products 1142209-42-4

CAS 1142209-42-4 is the registry number for 3-(3-Methyl-1-phenyl-1h-1,2,4-triazol-5-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propanoic acid (CAS 1142209-42-4) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 3-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propanoic acid. InChIKey: QCZWDCOKZVFUKF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13N3O2
Molecular weight231.25 g/mol
IUPAC name3-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propanoic acid
InChIKeyQCZWDCOKZVFUKF-UHFFFAOYSA-N
SMILESCC1=NN(C(=N1)CCC(=O)O)C2=CC=CC=C2

Computed by PubChem (NCBI)