CAS 1142209-42-4 is the registry number for 3-(3-Methyl-1-phenyl-1h-1,2,4-triazol-5-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propanoic acid (CAS 1142209-42-4) is a chemical compound with the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. IUPAC name: 3-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propanoic acid. InChIKey: QCZWDCOKZVFUKF-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 3-(5-methyl-2-phenyl-1,2,4-triazol-3-yl)propanoic acid |
| InChIKey | QCZWDCOKZVFUKF-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)CCC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)