CAS 1142209-94-6 appears in our catalog under these names: 1-[(3,5-Dimethyl-1h-pyrrol-2-yl)carbonyl]piperidine-3-carboxylic acid, 95%, 1-(3,5-Dimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxylic acid, 97+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxylic acid (CAS 1142209-94-6) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: 1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxylic acid. InChIKey: LTUAQLZDZOZVEL-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 1-(3,5-dimethyl-1H-pyrrole-2-carbonyl)piperidine-3-carboxylic acid |
| InChIKey | LTUAQLZDZOZVEL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1)C(=O)N2CCCC(C2)C(=O)O)C |
Computed by PubChem (NCBI)