Products 1142214-43-4
CAS 1142214-43-4 is the registry number for 2,2-Dimethyl-3-((4-phenylpiperazin-1-yl)carbonyl)cyclopropanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
2,2-dimethyl-3-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxylic acid (CAS 1142214-43-4) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: 2,2-dimethyl-3-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxylic acid. InChIKey: ZBUDMDXRASMIIO-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | 2,2-dimethyl-3-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxylic acid |
| InChIKey | ZBUDMDXRASMIIO-UHFFFAOYSA-N |
| SMILES | CC1(C(C1C(=O)O)C(=O)N2CCN(CC2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)