Products 114434-14-9

CAS 114434-14-9 is the registry number for 6-((6-Hydroxyhexyl)oxy)-2-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-(6-hydroxyhexoxy)naphthalene-2-carboxylic acid (CAS 114434-14-9) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 6-(6-hydroxyhexoxy)naphthalene-2-carboxylic acid. InChIKey: HOGWHQUXNIHDNN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20O4
Molecular weight288.34 g/mol
IUPAC name6-(6-hydroxyhexoxy)naphthalene-2-carboxylic acid
InChIKeyHOGWHQUXNIHDNN-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)OCCCCCCO)C=C1C(=O)O

Computed by PubChem (NCBI)