Products 1360556-56-4
CAS 1360556-56-4 is the registry number for rel-6-Benzyl 7-methyl (1S,5R,6S,7R)-bicyclo[3.2.0]heptane-6,7-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-O-benzyl 7-O-methyl (1S,5R,6S,7R)-bicyclo[3.2.0]heptane-6,7-dicarboxylate (CAS 1360556-56-4) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 6-O-benzyl 7-O-methyl (1S,5R,6S,7R)-bicyclo[3.2.0]heptane-6,7-dicarboxylate. InChIKey: HXPKTPVMKHQZPO-YJNKXOJESA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 6-O-benzyl 7-O-methyl (1S,5R,6S,7R)-bicyclo[3.2.0]heptane-6,7-dicarboxylate |
| InChIKey | HXPKTPVMKHQZPO-YJNKXOJESA-N |
| SMILES | COC(=O)[C@@H]1[C@H]2CCC[C@H]2[C@@H]1C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)