CAS 51049-71-9 appears in our catalog under these names: 5-(1-Adamantyl)-2,4-dihydroxybenzoic acid, 95%, 5-(Adamantan-1-yl)-2,4-dihydroxybenzoic acid, 98%, 98%, 5-(1-adamantyl)-2,4-dihydroxybenzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-(1-adamantyl)-2,4-dihydroxybenzoic acid (CAS 51049-71-9) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 5-(1-adamantyl)-2,4-dihydroxybenzoic acid. InChIKey: CPPPOEUQYCKODN-UHFFFAOYSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 5-(1-adamantyl)-2,4-dihydroxybenzoic acid |
| InChIKey | CPPPOEUQYCKODN-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=C(C=C(C(=C4)C(=O)O)O)O |
Computed by PubChem (NCBI)