CAS 2226386-35-0 is the registry number for (R)-3-(3-(3,4-Dimethoxyphenyl)-1-hydroxypropyl)phenol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-[(1R)-3-(3,4-dimethoxyphenyl)-1-hydroxypropyl]phenol (CAS 2226386-35-0) is a chemical compound with the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. IUPAC name: 3-[(1R)-3-(3,4-dimethoxyphenyl)-1-hydroxypropyl]phenol. InChIKey: SDYVLCCZUKPFOJ-OAHLLOKOSA-N.
| Molecular formula | C17H20O4 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | 3-[(1R)-3-(3,4-dimethoxyphenyl)-1-hydroxypropyl]phenol |
| InChIKey | SDYVLCCZUKPFOJ-OAHLLOKOSA-N |
| SMILES | COC1=C(C=C(C=C1)CC[C@H](C2=CC(=CC=C2)O)O)OC |
Computed by PubChem (NCBI)