CAS 114476-84-5 is the registry number for 3-Chlorophenoxyacetyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-chlorophenoxy)acetyl chloride (CAS 114476-84-5) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(3-chlorophenoxy)acetyl chloride. InChIKey: KPINZNVDHXIYAR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(3-chlorophenoxy)acetyl chloride |
| InChIKey | KPINZNVDHXIYAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OCC(=O)Cl |
Computed by PubChem (NCBI)