CAS 1144853-48-4 is the registry number for 5-Thiomorpholinosulfonyl Isatin. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
5-thiomorpholin-4-ylsulfonyl-1H-indole-2,3-dione (CAS 1144853-48-4) is a chemical compound with the molecular formula C12H12N2O4S2 and a molecular weight of 312.4 g/mol. IUPAC name: 5-thiomorpholin-4-ylsulfonyl-1H-indole-2,3-dione. InChIKey: UYTDODWBVJYAQH-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 5-thiomorpholin-4-ylsulfonyl-1H-indole-2,3-dione |
| InChIKey | UYTDODWBVJYAQH-UHFFFAOYSA-N |
| SMILES | C1CSCCN1S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3=O |
Computed by PubChem (NCBI)