CAS 376638-03-8 appears in our catalog under these names: (2-([(4-Methylphenyl)sulfonyl]amino)-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(4-Methylphenylsulfonamido)thiazol-4-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-[2-[(4-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 376638-03-8) is a chemical compound with the molecular formula C12H12N2O4S2 and a molecular weight of 312.4 g/mol. IUPAC name: 2-[2-[(4-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: AYKJIFPXBJZYOI-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 2-[2-[(4-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | AYKJIFPXBJZYOI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)