CAS 1283108-29-1 is the registry number for 1-(6-(methylsulfonyl)-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid (CAS 1283108-29-1) is a chemical compound with the molecular formula C12H12N2O4S2 and a molecular weight of 312.4 g/mol. IUPAC name: 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid. InChIKey: OQEIVGRFCPQVDW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 1-(6-methylsulfonyl-1,3-benzothiazol-2-yl)azetidine-3-carboxylic acid |
| InChIKey | OQEIVGRFCPQVDW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N=C(S2)N3CC(C3)C(=O)O |
Computed by PubChem (NCBI)