CAS 1153874-48-6 appears in our catalog under these names: 3-{(1-(pyridin-4-yl)ethyl)sulfamoyl}thiophene-2-carboxylic acid, 95%, 3-{(1-(Pyridin-4-yl)ethyl)sulfamoyl}thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(1-pyridin-4-ylethylsulfamoyl)thiophene-2-carboxylic acid (CAS 1153874-48-6) is a chemical compound with the molecular formula C12H12N2O4S2 and a molecular weight of 312.4 g/mol. IUPAC name: 3-(1-pyridin-4-ylethylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: KCDSGIMKNIQTGX-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4S2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 3-(1-pyridin-4-ylethylsulfamoyl)thiophene-2-carboxylic acid |
| InChIKey | KCDSGIMKNIQTGX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=NC=C1)NS(=O)(=O)C2=C(SC=C2)C(=O)O |
Computed by PubChem (NCBI)