CAS 1145671-66-4 is the registry number for (3S,4R)-Methyl 4-phenylpyrrolidine-3-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
Methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate (CAS 1145671-66-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate. InChIKey: RHZYPIMJMZIAGF-WDEREUQCSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | methyl (3S,4R)-4-phenylpyrrolidine-3-carboxylate |
| InChIKey | RHZYPIMJMZIAGF-WDEREUQCSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C2=CC=CC=C2 |
Computed by PubChem (NCBI)