Products 1145678-21-2
CAS 1145678-21-2 is the registry number for 4-[(2-ethoxy-2-oxoethyl)sulfanyl]-3-nitrobenzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(methylcarbamoyl)phenyl]propanoic acid (CAS 1145678-21-2) is a chemical compound with the molecular formula C26H24N2O5 and a molecular weight of 444.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(methylcarbamoyl)phenyl]propanoic acid. InChIKey: TYCCOAIPAWNMTD-QHCPKHFHSA-N.
| Molecular formula | C26H24N2O5 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(methylcarbamoyl)phenyl]propanoic acid |
| InChIKey | TYCCOAIPAWNMTD-QHCPKHFHSA-N |
| SMILES | CNC(=O)C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)