Products 1146080-20-7

CAS 1146080-20-7 is the registry number for 4-(4-Vinyl-phenoxy)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(4-ethenylphenoxy)piperidine-1-carboxylate (CAS 1146080-20-7) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: tert-butyl 4-(4-ethenylphenoxy)piperidine-1-carboxylate. InChIKey: PKNWHAWRYMDXIF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H25NO3
Molecular weight303.4 g/mol
IUPAC nametert-butyl 4-(4-ethenylphenoxy)piperidine-1-carboxylate
InChIKeyPKNWHAWRYMDXIF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)OC2=CC=C(C=C2)C=C

Computed by PubChem (NCBI)