CAS 912768-78-6 is the registry number for tert-Butyl 4-(4-methylbenzoyl)piperidine-1-carboxylate, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
Tert-butyl 4-(4-methylbenzoyl)piperidine-1-carboxylate (CAS 912768-78-6) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: tert-butyl 4-(4-methylbenzoyl)piperidine-1-carboxylate. InChIKey: MNYKXVMLBQMOEE-UHFFFAOYSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | tert-butyl 4-(4-methylbenzoyl)piperidine-1-carboxylate |
| InChIKey | MNYKXVMLBQMOEE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)