CAS 231938-26-4 is the registry number for tert-Butyl (S)-3-hydroxy-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1S)-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate (CAS 231938-26-4) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: tert-butyl (1S)-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate. InChIKey: JQDUYDRMSSWISY-HNNXBMFYSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | tert-butyl (1S)-1-hydroxyspiro[1,2-dihydroindene-3,4'-piperidine]-1'-carboxylate |
| InChIKey | JQDUYDRMSSWISY-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C[C@@H](C3=CC=CC=C23)O |
Computed by PubChem (NCBI)