CAS 2306253-20-1 is the registry number for tert-Butyl (R)-1-hydroxy-1,3-dihydrospiro[indene-2,4'-piperidine]-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (1R)-1-hydroxyspiro[3H-indene-2,4'-piperidine]-1-carboxylate (CAS 2306253-20-1) is a chemical compound with the molecular formula C18H25NO3 and a molecular weight of 303.4 g/mol. IUPAC name: tert-butyl (1R)-1-hydroxyspiro[3H-indene-2,4'-piperidine]-1-carboxylate. InChIKey: QJQYAOYPTNQVRX-GOSISDBHSA-N.
| Molecular formula | C18H25NO3 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | tert-butyl (1R)-1-hydroxyspiro[3H-indene-2,4'-piperidine]-1-carboxylate |
| InChIKey | QJQYAOYPTNQVRX-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@]1(C2=CC=CC=C2CC13CCNCC3)O |
Computed by PubChem (NCBI)