Products 114609-65-3

CAS 114609-65-3 is the registry number for Guaifenesin EP Impurity B-d4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,1,3,3-tetradeuterio-2-(2-methoxyphenoxy)propane-1,3-diol (CAS 114609-65-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 202.24 g/mol. IUPAC name: 1,1,3,3-tetradeuterio-2-(2-methoxyphenoxy)propane-1,3-diol. InChIKey: DTADPBLDQSWASV-KXGHAPEVSA-N.

Identity
Molecular formulaC10H14O4
Molecular weight202.24 g/mol
IUPAC name1,1,3,3-tetradeuterio-2-(2-methoxyphenoxy)propane-1,3-diol
InChIKeyDTADPBLDQSWASV-KXGHAPEVSA-N
SMILES[2H]C([2H])(C(C([2H])([2H])O)OC1=CC=CC=C1OC)O

Computed by PubChem (NCBI)