CAS 114609-65-3 is the registry number for Guaifenesin EP Impurity B-d4. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,3,3-tetradeuterio-2-(2-methoxyphenoxy)propane-1,3-diol (CAS 114609-65-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 202.24 g/mol. IUPAC name: 1,1,3,3-tetradeuterio-2-(2-methoxyphenoxy)propane-1,3-diol. InChIKey: DTADPBLDQSWASV-KXGHAPEVSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 202.24 g/mol |
| IUPAC name | 1,1,3,3-tetradeuterio-2-(2-methoxyphenoxy)propane-1,3-diol |
| InChIKey | DTADPBLDQSWASV-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C(C([2H])([2H])O)OC1=CC=CC=C1OC)O |
Computed by PubChem (NCBI)