Products 1146289-82-8
CAS 1146289-82-8 is the registry number for 2-Chloro-n-(2-chloro-4,6-dimethylphenyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(2-chloro-4,6-dimethylphenyl)propanamide (CAS 1146289-82-8) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: 2-chloro-N-(2-chloro-4,6-dimethylphenyl)propanamide. InChIKey: SFHOWCDKGLMGIU-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 2-chloro-N-(2-chloro-4,6-dimethylphenyl)propanamide |
| InChIKey | SFHOWCDKGLMGIU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)NC(=O)C(C)Cl)C |
Computed by PubChem (NCBI)