CAS 79868-32-9 is the registry number for 2,5-Dichloro-n,n-diethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,5-dichloro-N,N-diethylbenzamide (CAS 79868-32-9) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: 2,5-dichloro-N,N-diethylbenzamide. InChIKey: QZQZZQVSKHUZSS-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 2,5-dichloro-N,N-diethylbenzamide |
| InChIKey | QZQZZQVSKHUZSS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)