CAS 905552-17-2 is the registry number for N-tert-Butyl-2,3-dichlorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-tert-butyl-2,3-dichlorobenzamide (CAS 905552-17-2) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: N-tert-butyl-2,3-dichlorobenzamide. InChIKey: CJDRROQVOXQEQA-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | N-tert-butyl-2,3-dichlorobenzamide |
| InChIKey | CJDRROQVOXQEQA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)