CAS 405147-35-5 is the registry number for N-butyl-2,5-dichlorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-butyl-2,5-dichlorobenzamide (CAS 405147-35-5) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: N-butyl-2,5-dichlorobenzamide. InChIKey: KLNMGSDUEFYTSQ-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | N-butyl-2,5-dichlorobenzamide |
| InChIKey | KLNMGSDUEFYTSQ-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)