CAS 1146290-40-5 is the registry number for 7-Bromo-5-(chloromethyl)-2,2-dimethyl-2,3-dihydro-1-benzofuran, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7-bromo-5-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran (CAS 1146290-40-5) is a chemical compound with the molecular formula C11H12BrClO and a molecular weight of 275.57 g/mol. IUPAC name: 7-bromo-5-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran. InChIKey: JUWFLUSEUOEQKY-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | 7-bromo-5-(chloromethyl)-2,2-dimethyl-3H-1-benzofuran |
| InChIKey | JUWFLUSEUOEQKY-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC(=C2)CCl)Br)C |
Computed by PubChem (NCBI)