Products 1566263-95-3
CAS 1566263-95-3 is the registry number for 7-(1-Bromopropyl)-5-chloro-2,3-dihydro-1-benzofuran. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-(1-bromopropyl)-5-chloro-2,3-dihydro-1-benzofuran (CAS 1566263-95-3) is a chemical compound with the molecular formula C11H12BrClO and a molecular weight of 275.57 g/mol. IUPAC name: 7-(1-bromopropyl)-5-chloro-2,3-dihydro-1-benzofuran. InChIKey: OSRCYWGQHMZVFO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | 7-(1-bromopropyl)-5-chloro-2,3-dihydro-1-benzofuran |
| InChIKey | OSRCYWGQHMZVFO-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC2=C1OCC2)Cl)Br |
Computed by PubChem (NCBI)