CAS 1280786-86-8 is the registry number for 4-Bromo-1-chloro-2-(cyclopentyloxy)benzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-1-chloro-2-cyclopentyloxybenzene (CAS 1280786-86-8) is a chemical compound with the molecular formula C11H12BrClO and a molecular weight of 275.57 g/mol. IUPAC name: 4-bromo-1-chloro-2-cyclopentyloxybenzene. InChIKey: APVQZRSNYYOSTJ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | 4-bromo-1-chloro-2-cyclopentyloxybenzene |
| InChIKey | APVQZRSNYYOSTJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)