CAS 2764733-83-5 is the registry number for 3-Bromo-2-chloro-5-(1,1-dimethylethyl)benzaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-bromo-5-tert-butyl-2-chlorobenzaldehyde (CAS 2764733-83-5) is a chemical compound with the molecular formula C11H12BrClO and a molecular weight of 275.57 g/mol. IUPAC name: 3-bromo-5-tert-butyl-2-chlorobenzaldehyde. InChIKey: HIPUCHSIHHDDNO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO |
|---|---|
| Molecular weight | 275.57 g/mol |
| IUPAC name | 3-bromo-5-tert-butyl-2-chlorobenzaldehyde |
| InChIKey | HIPUCHSIHHDDNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)Cl)C=O |
Computed by PubChem (NCBI)