CAS 1146614-40-5 appears in our catalog under these names: 3–Fluoro–5–(hydroxymethyl)phenylboronic Acid, 3-Fluoro-5-(hydroxymethyl)phenylboronic acid, 3-Fluoro-5-(hydroxymethyl)phenylboronic acid, 97%, 3-Fluoro-5-(hydroxymethyl)phenylboronic Acid, 97%, 97%, (3-Fluoro-5-(hydroxymethyl)phenyl)boronic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g, 25g, 100mg.
[3-fluoro-5-(hydroxymethyl)phenyl]boronic acid (CAS 1146614-40-5) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [3-fluoro-5-(hydroxymethyl)phenyl]boronic acid. InChIKey: BLNFWNSYUVQREC-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [3-fluoro-5-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | BLNFWNSYUVQREC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)CO)(O)O |
Computed by PubChem (NCBI)