CAS 1146699-64-0 appears in our catalog under these names: 3-(4-(Bromomethyl)-3-fluorophenyl)-1,2,4-oxadiazole, 95%, 3-(4-(Bromomethyl)-3-fluorophenyl)-1,2,4-oxadiazole, 97%, 3-(4-(Bromomethyl)-3-fluorophenyl)-1,2,4-oxadiazole, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg.
3-[4-(bromomethyl)-3-fluorophenyl]-1,2,4-oxadiazole (CAS 1146699-64-0) is a chemical compound with the molecular formula C9H6BrFN2O and a molecular weight of 257.06 g/mol. IUPAC name: 3-[4-(bromomethyl)-3-fluorophenyl]-1,2,4-oxadiazole. InChIKey: ZBKXTEJUTGXVJL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2O |
|---|---|
| Molecular weight | 257.06 g/mol |
| IUPAC name | 3-[4-(bromomethyl)-3-fluorophenyl]-1,2,4-oxadiazole |
| InChIKey | ZBKXTEJUTGXVJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NOC=N2)F)CBr |
Computed by PubChem (NCBI)