Products 2222158-91-8
CAS 2222158-91-8 is the registry number for 5-(5-Bromo-3-fluoropyridin-2-yl)-2-methyloxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-bromo-3-fluoro-2-pyridinyl)-2-methyl-1,3-oxazole (CAS 2222158-91-8) is a chemical compound with the molecular formula C9H6BrFN2O and a molecular weight of 257.06 g/mol. IUPAC name: 5-(5-bromo-3-fluoro-2-pyridinyl)-2-methyl-1,3-oxazole. InChIKey: LUDYNSUZVJJZIV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2O |
|---|---|
| Molecular weight | 257.06 g/mol |
| IUPAC name | 5-(5-bromo-3-fluoro-2-pyridinyl)-2-methyl-1,3-oxazole |
| InChIKey | LUDYNSUZVJJZIV-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(O1)C2=C(C=C(C=N2)Br)F |
Computed by PubChem (NCBI)