CAS 1597594-09-6 appears in our catalog under these names: 6-Bromo-7-fluoro-2-methylquinazolin-4-ol, 95%, 6-Bromo-7-fluoro-2-methylquinazolin-4(1H)-one 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
6-bromo-7-fluoro-2-methyl-3H-quinazolin-4-one (CAS 1597594-09-6) is a chemical compound with the molecular formula C9H6BrFN2O and a molecular weight of 257.06 g/mol. IUPAC name: 6-bromo-7-fluoro-2-methyl-3H-quinazolin-4-one. InChIKey: OJAGKZMDYTUCHN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2O |
|---|---|
| Molecular weight | 257.06 g/mol |
| IUPAC name | 6-bromo-7-fluoro-2-methyl-3H-quinazolin-4-one |
| InChIKey | OJAGKZMDYTUCHN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2C(=O)N1)Br)F |
Computed by PubChem (NCBI)