Products 2721375-64-8
CAS 2721375-64-8 is the registry number for 6-Bromo-8-fluoro-1,4-dihydrocinnoline-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-fluoro-1,4-dihydrocinnoline-3-carbaldehyde (CAS 2721375-64-8) is a chemical compound with the molecular formula C9H6BrFN2O and a molecular weight of 257.06 g/mol. IUPAC name: 6-bromo-8-fluoro-1,4-dihydrocinnoline-3-carbaldehyde. InChIKey: OORAKYRPANEDSG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2O |
|---|---|
| Molecular weight | 257.06 g/mol |
| IUPAC name | 6-bromo-8-fluoro-1,4-dihydrocinnoline-3-carbaldehyde |
| InChIKey | OORAKYRPANEDSG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Br)F)NN=C1C=O |
Computed by PubChem (NCBI)