Products 1147-98-4
CAS 1147-98-4 appears in our catalog under these names: 5-Chloro-N-(4-chlorophenyl)-2-hydroxybenzamide, 5–chloro–N–(4–chlorophenyl)–2–hydroxy–benzamide. Offered by: Chemat, GLPBio. Available pack sizes: 250mg, 1g.
5-chloro-N-(4-chlorophenyl)-2-hydroxybenzamide (CAS 1147-98-4) is a chemical compound with the molecular formula C13H9Cl2NO2 and a molecular weight of 282.12 g/mol. IUPAC name: 5-chloro-N-(4-chlorophenyl)-2-hydroxybenzamide. InChIKey: PVWWOFBIYKSBEX-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2NO2 |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | 5-chloro-N-(4-chlorophenyl)-2-hydroxybenzamide |
| InChIKey | PVWWOFBIYKSBEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl |
Computed by PubChem (NCBI)