Products 114701-91-6

CAS 114701-91-6 is the registry number for 3-Methyl-1,2,3-butanetricarboxylic Acid Trimethyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Trimethyl 3-methylbutane-1,2,3-tricarboxylate (CAS 114701-91-6) is a chemical compound with the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. IUPAC name: trimethyl 3-methylbutane-1,2,3-tricarboxylate. InChIKey: JQZBCMNJXDJLFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O6
Molecular weight246.26 g/mol
IUPAC nametrimethyl 3-methylbutane-1,2,3-tricarboxylate
InChIKeyJQZBCMNJXDJLFQ-UHFFFAOYSA-N
SMILESCC(C)(C(CC(=O)OC)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)