Products 58700-99-5

CAS 58700-99-5 is the registry number for 2-Ethyl-4-methoxy-5-methyl-3-oxoheptanedioic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethyl-4-methoxy-5-methyl-3-oxoheptanedioic acid (CAS 58700-99-5) is a chemical compound with the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. IUPAC name: 2-ethyl-4-methoxy-5-methyl-3-oxoheptanedioic acid. InChIKey: GVUZVXBOZTVMTN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O6
Molecular weight246.26 g/mol
IUPAC name2-ethyl-4-methoxy-5-methyl-3-oxoheptanedioic acid
InChIKeyGVUZVXBOZTVMTN-UHFFFAOYSA-N
SMILESCCC(C(=O)C(C(C)CC(=O)O)OC)C(=O)O

Computed by PubChem (NCBI)