CAS 402508-35-4 is the registry number for Pitavastatin Impurity 109. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 402508-35-4) is a chemical compound with the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. IUPAC name: 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: LVEYWLQIQCNKJR-BDAKNGLRSA-N.
| Molecular formula | C11H18O6 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| InChIKey | LVEYWLQIQCNKJR-BDAKNGLRSA-N |
| SMILES | CC(=O)OC[C@@H]1C[C@@H](OC(O1)(C)C)CC(=O)O |
Computed by PubChem (NCBI)