Products 402508-35-4

CAS 402508-35-4 is the registry number for Pitavastatin Impurity 109. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (CAS 402508-35-4) is a chemical compound with the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. IUPAC name: 2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid. InChIKey: LVEYWLQIQCNKJR-BDAKNGLRSA-N.

Identity
Molecular formulaC11H18O6
Molecular weight246.26 g/mol
IUPAC name2-[(4R,6S)-6-(acetyloxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid
InChIKeyLVEYWLQIQCNKJR-BDAKNGLRSA-N
SMILESCC(=O)OC[C@@H]1C[C@@H](OC(O1)(C)C)CC(=O)O

Computed by PubChem (NCBI)