CAS 56543-05-6 is the registry number for cis-Diethyl 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl (4R,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate (CAS 56543-05-6) is a chemical compound with the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. IUPAC name: diethyl (4R,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate. InChIKey: MCNKHXZIPATURB-OCAPTIKFSA-N.
| Molecular formula | C11H18O6 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | diethyl (4R,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
| InChIKey | MCNKHXZIPATURB-OCAPTIKFSA-N |
| SMILES | CCOC(=O)[C@H]1[C@H](OC(O1)(C)C)C(=O)OCC |
Computed by PubChem (NCBI)