Products 1147558-16-4
CAS 1147558-16-4 is the registry number for 4-(Cyclopropylsulfonyl)-2-methylaniline, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-cyclopropylsulfonyl-2-methylaniline (CAS 1147558-16-4) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 4-cyclopropylsulfonyl-2-methylaniline. InChIKey: HESZQUCYSOZOMJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 4-cyclopropylsulfonyl-2-methylaniline |
| InChIKey | HESZQUCYSOZOMJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)C2CC2)N |
Computed by PubChem (NCBI)