Products 1147746-77-7

CAS 1147746-77-7 is the registry number for 2-[3-(Propan-2-yl)-1h-1,2,4-triazol-5-yl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)aniline (CAS 1147746-77-7) is a chemical compound with the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. IUPAC name: 2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)aniline. InChIKey: AQXJICYQPAOGGM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N4
Molecular weight202.26 g/mol
IUPAC name2-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)aniline
InChIKeyAQXJICYQPAOGGM-UHFFFAOYSA-N
SMILESCC(C)C1=NC(=NN1)C2=CC=CC=C2N

Computed by PubChem (NCBI)