CAS 478827-33-7 appears in our catalog under these names: 5-(Piperazin-1-yl)-1h-indazole, 95%, 5-(Piperazin-1-yl)-1H-indazole, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg.
5-piperazin-1-yl-1H-indazole (CAS 478827-33-7) is a chemical compound with the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. IUPAC name: 5-piperazin-1-yl-1H-indazole. InChIKey: YTXAVWZKFXHQBK-UHFFFAOYSA-N.
| Molecular formula | C11H14N4 |
|---|---|
| Molecular weight | 202.26 g/mol |
| IUPAC name | 5-piperazin-1-yl-1H-indazole |
| InChIKey | YTXAVWZKFXHQBK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC3=C(C=C2)NN=C3 |
Computed by PubChem (NCBI)