CAS 763910-07-2 appears in our catalog under these names: 6-(Piperazin-1-yl)-1h-indazole, 95%, 6–(Piperazin–1–yl)–1H–indazole, 6-(Piperazin-1-yl)-1H-indazole 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
6-piperazin-1-yl-1H-indazole (CAS 763910-07-2) is a chemical compound with the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. IUPAC name: 6-piperazin-1-yl-1H-indazole. InChIKey: SAOSRZZZVNSGKU-UHFFFAOYSA-N.
| Molecular formula | C11H14N4 |
|---|---|
| Molecular weight | 202.26 g/mol |
| IUPAC name | 6-piperazin-1-yl-1H-indazole |
| InChIKey | SAOSRZZZVNSGKU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC3=C(C=C2)C=NN3 |
Computed by PubChem (NCBI)