CAS 1498997-64-0 appears in our catalog under these names: 5-Methyl-1-(4-methylbenzyl)-1h-1,2,3-triazol-4-amine, 95%, 5-Methyl-1-(4-methylbenzyl)-1H-1,2,3-triazol-4-amine, 95%, 95%, 5-Methyl-1-(4-methylbenzyl)-1H-1,2,3-triazol-4-amine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 250mg.
5-methyl-1-[(4-methylphenyl)methyl]triazol-4-amine (CAS 1498997-64-0) is a chemical compound with the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. IUPAC name: 5-methyl-1-[(4-methylphenyl)methyl]triazol-4-amine. InChIKey: XUAWPMFXKGGWIN-UHFFFAOYSA-N.
| Molecular formula | C11H14N4 |
|---|---|
| Molecular weight | 202.26 g/mol |
| IUPAC name | 5-methyl-1-[(4-methylphenyl)methyl]triazol-4-amine |
| InChIKey | XUAWPMFXKGGWIN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=C(N=N2)N)C |
Computed by PubChem (NCBI)