Products 114856-91-6

CAS 114856-91-6 is the registry number for 2,2-Dimethyl-3-oxo-1-phenylpropyl carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-(2-methyl-1-oxopropan-2-yl)carbamate (CAS 114856-91-6) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: benzyl N-(2-methyl-1-oxopropan-2-yl)carbamate. InChIKey: DNFWFQPRWSKKDA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO3
Molecular weight221.25 g/mol
IUPAC namebenzyl N-(2-methyl-1-oxopropan-2-yl)carbamate
InChIKeyDNFWFQPRWSKKDA-UHFFFAOYSA-N
SMILESCC(C)(C=O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)