CAS 114873-11-9 appears in our catalog under these names: N–BOC–3–Fluoro–D–phenylalanine, Boc-D-Phe(3-F)-OH, Boc-D-Phe(3-F)-OH, 95%, 95%, N-BOC-3-Fluoro-D-phenylalanine, 99.67%, (R)-N-Boc-3-Fluorophenylalanine, 95%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 100mg, 250mg, 1g, 5 g.
(2R)-3-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 114873-11-9) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2R)-3-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FPCCREICRYPTTL-LLVKDONJSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2R)-3-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FPCCREICRYPTTL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)