CAS 1149354-06-2 appears in our catalog under these names: Boc-α-Me-Leu-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)-2,4-dimethylpentanoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1149354-06-2) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2S)-2,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GYOVBMLJVOOBQA-LBPRGKRZSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2S)-2,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GYOVBMLJVOOBQA-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@](C)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)