CAS 97534-52-6 appears in our catalog under these names: Boc-alpha-methyl-DL-leucine, Boc-DL-α-Me-Leu-OH 95%, 2-{[(tert-butoxy)carbonyl]amino}-2,4-dimethylpentanoic acid, 98%, 98%, 2-{[(tert-butoxy)carbonyl]amino}-2,4-dimethylpentanoic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 500mg, 5g, 10g.
2,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 97534-52-6) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 2,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: GYOVBMLJVOOBQA-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 2,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | GYOVBMLJVOOBQA-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)